
CAS 1092578-44-3
:Tofacitinib Impurity 20
Description:
Tofacitinib Impurity 20, with the CAS number 1092578-44-3, is a chemical compound that is recognized as an impurity associated with the pharmaceutical agent tofacitinib, which is used primarily in the treatment of autoimmune diseases such as rheumatoid arthritis. While specific characteristics of Tofacitinib Impurity 20 may not be widely documented, impurities in pharmaceutical compounds typically exhibit structural similarities to their parent compounds, potentially affecting their pharmacological properties. Such impurities can arise during the synthesis or storage of the drug and may influence the drug's efficacy, safety, and stability. The characterization of impurities often involves techniques such as chromatography, mass spectrometry, and nuclear magnetic resonance (NMR) spectroscopy to determine their chemical structure and properties. Regulatory agencies require thorough analysis of impurities to ensure the quality and safety of pharmaceutical products. Understanding the characteristics of impurities like Tofacitinib Impurity 20 is crucial for maintaining the integrity of drug formulations and ensuring patient safety.
Formula:C27H31N5O2S
InChI:InChI=1S/C27H31N5O2S/c1-20-9-11-23(12-10-20)35(33,34)32-16-14-24-26(28-19-29-27(24)32)30(3)25-18-31(15-13-21(25)2)17-22-7-5-4-6-8-22/h4-12,14,16,19,21,25H,13,15,17-18H2,1-3H3/t21-,25-/m0/s1
InChI key:GWMBPMUFLFJILW-OFVILXPXSA-N
SMILES:C[C@H]1CCN(C[C@@H]1N(C)C2=NC=NC3=C2C=CN3S(=O)(=O)C4=CC=C(C=C4)C)CC5=CC=CC=C5
Synonyms:- Tofatinib Impurity 20
- Tofacitinib Impurity 134
- 7H-Pyrrolo[2,3-d]pyrimidin-4-amine, N-methyl-N-[(3R,4S)-4-methyl-1-(phenylmethyl)-3-piperidinyl]-7-[(4-methylphenyl)sulfonyl]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
