CymitQuimica logo

CAS 1092712-19-0

:

2,2,2-Trifluoro-1-(2,4,6-trifluoro-phenyl)-ethanone

Description:
2,2,2-Trifluoro-1-(2,4,6-trifluoro-phenyl)-ethanone is a fluorinated organic compound characterized by its trifluoromethyl groups, which significantly influence its chemical properties. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis and pharmaceuticals. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it resistant to hydrolysis and oxidation. Additionally, the trifluorophenyl moiety can impart unique electronic properties, affecting its interaction with biological systems and materials. The compound is likely to be a solid at room temperature, with a relatively high melting point due to the strong intermolecular forces associated with the fluorinated structure. Its synthesis typically involves the introduction of fluorine substituents onto aromatic rings, which can be achieved through various fluorination techniques. Overall, 2,2,2-Trifluoro-1-(2,4,6-trifluoro-phenyl)-ethanone is of interest in fields such as medicinal chemistry and materials science due to its distinctive properties and potential utility in developing new compounds.
Formula:C8H2F6O
InChI:InChI=1S/C8H2F6O/c9-3-1-4(10)6(5(11)2-3)7(15)8(12,13)14/h1-2H
InChI key:ZPDGQFMOKUFGSK-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)C(=O)C(F)(F)F)F)F
Synonyms:
  • Ethanone, 2,2,2-trifluoro-1-(2,4,6-trifluorophenyl)-
  • 2,2,2-trifluoro-1-(2,4,6-trifluorophenyl)ethan-1-one
  • 2,2,2-Trifluoro-1-(2,4,6-trifluoro-phenyl)-ethanone
Found 3 products.