CymitQuimica logo

CAS 1092961-07-3

:

1H-Indazole,4-fluoro-1-methyl-

Description:
1H-Indazole, 4-fluoro-1-methyl- is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a fluorine atom at the 4-position and a methyl group at the 1-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for its biological activity. The fluorine substitution can enhance the compound's lipophilicity and metabolic stability, making it an interesting candidate for drug design. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which may affect its interaction with biological targets. Overall, 1H-Indazole, 4-fluoro-1-methyl- represents a valuable structure in the field of organic and medicinal chemistry.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-11-8-4-2-3-7(9)6(8)5-10-11/h2-5H,1H3
InChI key:CMBZCBOBAXOMTI-UHFFFAOYSA-N
SMILES:CN1C2=C(C=N1)C(=CC=C2)F
Found 3 products.