CymitQuimica logo

CAS 1092961-08-4

:

1-Methyl-1H-indazole-7-methanol

Description:
1-Methyl-1H-indazole-7-methanol is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methyl group at the 1-position and a hydroxymethyl group at the 7-position of the indazole ring, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the indazole moiety. As with many organic compounds, its stability can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Further studies may be required to fully elucidate its properties and potential applications in various fields.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-11-9-7(5-10-11)3-2-4-8(9)6-12/h2-5,12H,6H2,1H3
InChI key:InChIKey=DNRBEEHECQQHAI-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(C=NN2C)=CC=C1
Synonyms:
  • 1H-Indazole-7-methanol, 1-methyl-
  • 1-Methyl-1H-indazole-7-methanol
Found 3 products.