CymitQuimica logo

CAS 1092961-11-9

:

(1-methyl-1H-indazol-5-yl)methanol

Description:
(1-methyl-1H-indazol-5-yl)methanol is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a methyl group at the 1-position and a hydroxymethyl group at the 5-position contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the hydroxymethyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives are known for various biological activities. The compound may exhibit properties such as anti-inflammatory, analgesic, or anticancer effects, although specific biological activities would require empirical investigation. Additionally, its stability and reactivity can be influenced by the functional groups present, making it a candidate for further research in synthetic and medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-11-9-3-2-7(6-12)4-8(9)5-10-11/h2-5,12H,6H2,1H3
InChI key:ASOJENREUJHTMD-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C(C=C2)CO)C=N1
Found 5 products.