CymitQuimica logo

CAS 1093092-14-8

:

4-Bromo-2,3-dichlorofluorobenzene

Description:
4-Bromo-2,3-dichlorofluorobenzene is an aromatic halogenated compound characterized by the presence of bromine, chlorine, and fluorine substituents on a benzene ring. The molecular structure features a bromine atom at the para position relative to the fluorine atom, while two chlorine atoms are located at the ortho positions. This arrangement contributes to its unique chemical properties, including increased reactivity and potential applications in organic synthesis and materials science. The presence of multiple halogens can enhance its lipophilicity, making it useful in various chemical reactions and as an intermediate in the production of more complex molecules. Additionally, the compound may exhibit specific physical properties such as a distinct boiling point and melting point, influenced by the halogen substituents. Safety considerations are important when handling this compound, as halogenated aromatics can pose environmental and health risks. Overall, 4-Bromo-2,3-dichlorofluorobenzene is a significant compound in the field of synthetic organic chemistry.
Formula:C6H2BrCl2F
InChI:InChI=1S/C6H2BrCl2F/c7-3-1-2-4(10)6(9)5(3)8/h1-2H
InChI key:CBJHQGPVASQJFW-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1F)Cl)Cl)Br
Found 4 products.