CAS 1093228-16-0

Formula: C11H8O5

InChI: InChI=1S/C11H8O5/c1-4-8(13)5-2-3-6(12)10(15)7(5)11(16)9(4)14/h2-3,12-13,15H,1H3

InChI key: NKWUAYRVOYZNJX-UHFFFAOYSA-N

SMILES: CC1=C(C2=C(C(=C(C=C2)O)O)C(=O)C1=O)O

Dioncoquinone B

Controlled Product

CAS: 1093228-16-0

Formula: C₁₁H₈O₅

Color and Shape: Neat

Molecular weight: 220.178

Ref: TR-D088560

Dioncoquinone B

CAS: 1093228-16-0

Dioncoquinone B is a natural product, which is isolated from the marine-derived fungus Penicillium simplicissimum. It is characterized as a secondary metabolite with intriguing bioactive properties. The compound exhibits promising biological activities, leveraging its mode of action that often targets specific cellular pathways or enzymes, depending on the context of application and the biological system involved.

Formula: C₁₁H₈O₅

Purity: Min. 95%

Molecular weight: 220.18 g/mol

Ref: 3D-TTB22816