CymitQuimica logo

CAS 1093279-76-5

:

Tenofovir Disoproxil Dimer

Description:
Tenofovir Disoproxil Dimer, identified by its CAS number 1093279-76-5, is a chemical compound related to the antiviral medication tenofovir, which is primarily used in the treatment of HIV and hepatitis B. This substance is characterized by its structural modifications that enhance its pharmacological properties. It typically exhibits a high solubility in aqueous solutions, which is beneficial for its bioavailability. The compound functions as a nucleotide reverse transcriptase inhibitor (NRTI), disrupting viral replication by interfering with the reverse transcription process. Its mechanism of action involves the incorporation of the active metabolite into viral DNA, leading to chain termination. The dimer form may suggest a potential for improved efficacy or stability compared to its monomeric counterparts. Additionally, Tenofovir Disoproxil Dimer is subject to rigorous testing for safety and efficacy in clinical settings, and its pharmacokinetics are influenced by factors such as absorption, distribution, metabolism, and excretion. Overall, this compound represents a significant advancement in antiviral therapy.
Formula:C39H60N10O20P2
InChI:InChI=1S/C39H60N10O20P2/c1-24(2)66-36(50)56-18-62-70(54,63-19-57-37(51)67-25(3)4)22-60-28(9)11-48-16-46-30-32(42-14-44-34(30)48)40-13-41-33-31-35(45-15-43-33)49(17-47-31)12-29(10)61-23-71(55,64-20-58-38(52)68-26(5)6)65-21-59-39(53)69-27(7)8/h14-17,24-29H,11-13,18-23H2,1-10H3,(H,40,42,44)(H,41,43,45)/t28-,29-/m1/s1
InChI key:KRLKBWQXBSICEQ-FQLXRVMXSA-N
SMILES:C[C@H](CN1C=NC2=C(N=CN=C21)NCNC3=C4C(=NC=N3)N(C=N4)C[C@@H](C)OCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)OCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C
Found 7 products.