CymitQuimica logo

CAS 1093416-52-4

:

Methyl α,3,5-trimethyl-1H-pyrazole-4-acetate

Description:
Methyl α,3,5-trimethyl-1H-pyrazole-4-acetate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features three methyl groups attached to the pyrazole ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and solubility. The acetate functional group indicates the presence of an ester, which can affect the compound's polarity and reactivity, particularly in esterification and hydrolysis reactions. Methyl α,3,5-trimethyl-1H-pyrazole-4-acetate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its unique structure allows for potential applications in various fields, including medicinal chemistry and crop protection. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-5(9(12)13-4)8-6(2)10-11-7(8)3/h5H,1-4H3,(H,10,11)
InChI key:InChIKey=GSFYZPOXGNXPND-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(C)C=1C(C)=NNC1C
Synonyms:
  • Methyl α,3,5-trimethyl-1H-pyrazole-4-acetate
  • 1H-Pyrazole-4-acetic acid, α,3,5-trimethyl-, methyl ester
Found 1 products.