CymitQuimica logo

CAS 1093847-73-4

:

2-Chloro-N-ethyl-5-iodo-4-pyrimidinamine

Description:
2-Chloro-N-ethyl-5-iodo-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 2-position and an iodo group at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. The N-ethyl substituent enhances its lipophilicity, which may influence its biological activity and solubility properties. This compound is likely to exhibit properties typical of halogenated pyrimidines, such as potential antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it may participate in nucleophilic substitution reactions due to the presence of the halogen atoms. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the halogen substituents and the nitrogen atoms in the pyrimidine ring. Overall, 2-Chloro-N-ethyl-5-iodo-4-pyrimidinamine represents a versatile scaffold for further chemical modifications and biological evaluations.
Formula:C6H7ClIN3
InChI:InChI=1S/C6H7ClIN3/c1-2-9-5-4(8)3-10-6(7)11-5/h3H,2H2,1H3,(H,9,10,11)
InChI key:InChIKey=XUVJZTFMWHAKMP-UHFFFAOYSA-N
SMILES:N(CC)C=1C(I)=CN=C(Cl)N1
Synonyms:
  • (2-Chloro-5-iodo-pyrimidin-4-yl)-ethyl-amine
  • 2-Chloro-N-ethyl-5-iodo-4-pyrimidinamine
  • 4-Pyrimidinamine, 2-chloro-N-ethyl-5-iodo-
  • N-(2-Chloro-5-iodopyrimidin-4-yl)ethylamine
Found 1 products.