CymitQuimica logo

CAS 1093865-65-6

:

4-Fluoro-3-formylbenzoic acid methyl ester

Description:
4-Fluoro-3-formylbenzoic acid methyl ester is an organic compound characterized by its functional groups, which include a formyl group (-CHO) and an ester group (-COOCH3) attached to a benzoic acid framework. The presence of the fluorine atom at the para position relative to the formyl group influences the compound's reactivity and polarity, potentially enhancing its electrophilic character. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents such as ethanol and dichloromethane. Its structure allows for various applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound may also exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as it may pose hazards typical of organic compounds with reactive functional groups.
Formula:C9H7FO3
InChI:InChI=1S/C9H7FO3/c1-13-9(12)6-2-3-8(10)7(4-6)5-11/h2-5H,1H3
InChI key:VJWHOSFTDOXSAS-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(c(c1)C=O)F
Synonyms:
  • Methyl 4-fluoro-3-formylbenzoate
Found 4 products.