CymitQuimica logo

CAS 1093951-55-3

:

cis-3-Methylcyclobutanamine hydrochloride

Description:
Cis-3-Methylcyclobutanamine hydrochloride is a chemical compound characterized by its cyclic structure and amine functional group. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The "cis" configuration indicates that the methyl group and the amine group are on the same side of the cyclobutane ring, which can influence its steric and electronic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its potential interactions with biological systems, including receptor binding and enzyme activity. The presence of the hydrochloride moiety enhances its solubility, facilitating its use in various applications, including drug formulation. As with many amines, it may also exhibit basic properties, allowing it to participate in acid-base reactions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C5H12ClN
InChI:InChI=1S/C5H11N.ClH/c1-4-2-5(6)3-4;/h4-5H,2-3,6H2,1H3;1H
InChI key:VXDHLHFUJZFKHO-UHFFFAOYSA-N
SMILES:CC1CC(C1)N.Cl
Synonyms:
  • cis-3-Methylcyclobutan-1-amine hydrochloride
  • cis-3-Methylcyclobutanamine hydrochloride
  • (1s,3s)-3-methylcyclobutanamine hydrochloride
Found 3 products.