CymitQuimica logo

CAS 1094107-42-2

:

Methyl 2-amino[1,2,4]triazolo[1,5-a]pyridine-7-carboxylate

Description:
Methyl 2-amino[1,2,4]triazolo[1,5-a]pyridine-7-carboxylate is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a methyl ester functional group, which contributes to its solubility and reactivity. The presence of the amino group enhances its potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. The triazole ring is known for its stability and ability to participate in various chemical reactions, while the pyridine moiety can influence the compound's electronic properties and reactivity. This substance may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in areas related to antimicrobial or anticancer research. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, Methyl 2-amino[1,2,4]triazolo[1,5-a]pyridine-7-carboxylate represents a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H8N4O2
InChI:InChI=1S/C8H8N4O2/c1-14-7(13)5-2-3-12-6(4-5)10-8(9)11-12/h2-4H,1H3,(H2,9,11)
InChI key:InChIKey=IPUSVZCQXUEIAE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=2N(N=C(N)N2)C=C1
Synonyms:
  • Methyl 2-amino[1,2,4]triazolo[1,5-a]pyridine-7-carboxylate
  • [1,2,4]Triazolo[1,5-a]pyridine-7-carboxylic acid, 2-amino-, methyl ester
Found 3 products.