CymitQuimica logo

CAS 109428-53-7

:

2-Azabicyclo[3.3.0]octane-3-carboxylic acid

Description:
2-Azabicyclo[3.3.0]octane-3-carboxylic acid, also known by its CAS number 109428-53-7, is a bicyclic compound characterized by a nitrogen atom incorporated into a bicyclic structure. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The bicyclic framework consists of two fused cyclohexane rings, creating a unique three-dimensional shape that can influence its biological activity and interactions with other molecules. The presence of the nitrogen atom in the ring structure can also impart basic properties, allowing for potential interactions with various biological targets. This compound is of interest in medicinal chemistry and pharmacology, particularly for its potential applications in drug development, as it may exhibit properties relevant to neurotransmitter modulation or other biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups, making it a subject of study in various chemical and biological contexts.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c10-8(11)7-4-5-2-1-3-6(5)9-7/h5-7,9H,1-4H2,(H,10,11)
InChI key:OQHKEWIEKYQINX-ACZMJKKPSA-N
SMILES:C1CC2CC(C(=O)O)NC2C1
Synonyms:
  • Cyclopenta[b]pyrrole-2-carboxylic acid, octahydro-, (2S,3aS,6aS)- (9CI)
  • (2S,3aS,6aS)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid
  • Octahydrocyclopenta[B]Pyrrole-2-Carboxylic Acid
Found 3 products.