CymitQuimica logo

CAS 1094293-78-3

:

2-(4-Bromo-2-thienyl)-4-thiazoleacetic acid

Description:
2-(4-Bromo-2-thienyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a thienyl group. The presence of the bromine atom at the para position of the thienyl moiety enhances its reactivity and potential biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. It may also demonstrate significant solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The thiazole and thienyl components suggest potential interactions with biological targets, indicating that this compound could be of interest in pharmaceutical research. Additionally, its molecular structure may confer specific electronic properties, influencing its behavior in chemical reactions and interactions with other molecules. Overall, 2-(4-Bromo-2-thienyl)-4-thiazoleacetic acid represents a versatile compound with potential applications in both research and industry.
Formula:C9H6BrNO2S2
InChI:InChI=1S/C9H6BrNO2S2/c10-5-1-7(14-3-5)9-11-6(4-15-9)2-8(12)13/h1,3-4H,2H2,(H,12,13)
InChI key:InChIKey=DIWICFWGJWBALI-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N=C(SC1)C=2SC=C(Br)C2
Synonyms:
  • 2-(4-Bromo-2-thienyl)-4-thiazoleacetic acid
  • 4-Thiazoleacetic acid, 2-(4-bromo-2-thienyl)-
Found 1 products.