CAS 1095253-39-6

ARQ-621

Description:

ARQ-621, identified by its CAS number 1095253-39-6, is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain biological pathways, which may contribute to its efficacy in treating specific conditions. The compound exhibits a unique molecular structure that influences its solubility, stability, and interaction with biological targets. ARQ-621 has been investigated for its role in modulating immune responses and has shown promise in preclinical studies for conditions such as cancer and autoimmune diseases. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are critical for understanding its behavior in biological systems. As research continues, the full spectrum of its characteristics, including potential side effects and optimal dosing regimens, will be elucidated, paving the way for its potential clinical applications.

Formula: C28H24Cl2FN5O2

InChI: InChI=1S/C28H24Cl2FN5O2/c1-2-8-24(35(16-7-15-32)27(37)21-11-6-12-22(30)25(21)31)26-33-23-17-18(29)13-14-20(23)28(38)36(26)34-19-9-4-3-5-10-19/h1,3-6,9-14,17,24,34H,7-8,15-16,32H2/t24-/m1/s1

InChI key: UPJSUQWHUVLLNW-XMMPIXPASA-N

SMILES: C#CC[C@H](C1=NC2=C(C=CC(=C2)Cl)C(=O)N1NC3=CC=CC=C3)N(CCCN)C(=O)C4=C(C(=CC=C4)Cl)F

ARQ 621

CAS: 1095253-39-6

ARQ 621

Formula: C₂₈H₂₄Cl₂FN₅O₂

Purity: 98%

Molecular weight: 552.43

Ref: 54-BUP02066

(R)-N-(3-Aminopropyl)-3-chloro-N-(1-(7-chloro-4-oxo-3-(phenylamino)-3,4-dihydroquinazolin-2-yl)but-3-yn-1-yl)-2-fluorobenzamide

CAS: 1095253-39-6

Formula: C₂₈H₂₄Cl₂FN₅O₂

Purity: 96%

Molecular weight: 552.4269

Ref: IN-DA008ZUU

(R)-N-(3-Aminopropyl)-3-chloro-N-(1-(7-chloro-4-oxo-3-(phenylamino)-3,4-dihydroquinazolin-2-yl)but-3-yn-1-yl)-2-fluorobenzamide

CAS: 1095253-39-6

(R)-N-(3-Aminopropyl)-3-chloro-N-(1-(7-chloro-4-oxo-3-(phenylamino)-3,4-dihydroquinazolin-2-yl)but-3-yn-1-yl)-2-fluorobenzamide

Formula: C₂₈H₂₄Cl₂FN₅O₂

Purity: 98%

Molecular weight: 552.43

Ref: IN-DG764825

ARQ 621

CAS: 1095253-39-6

ARQ 621 is an allosteric, and selective Eg5 mitotic motor protein inhibitor. Phase 1.

Formula: C₂₈H₂₄Cl₂FN₅O₂

Purity: 97.93% - 98.38%

Color and Shape: Yellow Solid

Molecular weight: 552.427

Ref: TM-T6393

ARQ 621

CAS: 1095253-39-6

ARQ 621 is a highly specialized molecular compound, primarily utilized as a selective inhibitor. It originates from a complex synthetic process involving advanced organic chemistry techniques. Its mode of action involves targeting specific enzymatic pathways, thereby inhibiting their activity at a molecular level. This allows for precise modulation of biochemical processes, offering unprecedented control in experimental settings.

Formula: C₂₈H₂₄Cl₂FN₅O₂

Purity: Min. 95%

Molecular weight: 552.43 g/mol

Ref: 3D-VTB25339