CymitQuimica logo

CAS 109528-50-9

:

hirudin (tyr(so3H)63)-fragment 55-65

Description:
Hirudin (tyr(so3H)63)-fragment 55-65 is a peptide derived from hirudin, a potent anticoagulant protein originally isolated from the salivary glands of leeches. This specific fragment consists of a sequence of amino acids that includes a sulfated tyrosine residue, which contributes to its biological activity. The presence of the sulfated tyrosine enhances the molecule's ability to interact with various proteins, particularly those involved in the coagulation cascade, thereby inhibiting thrombin and preventing blood clot formation. The CAS number 109528-50-9 uniquely identifies this compound in chemical databases, facilitating its study and application in research and medicine. Hirudin fragments are of interest in pharmacology for their potential therapeutic uses in treating thrombotic disorders. Additionally, the structural characteristics of this fragment, including its amino acid composition and modifications, play a crucial role in its stability, solubility, and overall biological function. Understanding these properties is essential for developing effective anticoagulant therapies based on hirudin derivatives.
Formula:C64H90N12O27S
InChI:InChI=1S/C64H90N12O27S/c1-5-33(4)53(75-58(92)41(21-26-51(84)85)68-55(89)38(18-23-48(78)79)69-60(94)44(29-34-10-7-6-8-11-34)72-54(88)37(65)31-52(86)87)63(97)76-27-9-12-46(76)62(96)70-40(20-25-50(82)83)56(90)67-39(19-24-49(80)81)57(91)74-45(30-35-13-15-36(16-14-35)103-104(100,101)102)61(95)73-43(28-32(2)3)59(93)71-42(64(98)99)17-22-47(66)77/h6-8,10-11,13-16,32-33,37-46,53H,5,9,12,17-31,65H2,1-4H3,(H2,66,77)(H,67,90)(H,68,89)(H,69,94)(H,70,96)(H,71,93)(H,72,88)(H,73,95)(H,74,91)(H,75,92)(H,78,79)(H,80,81)(H,82,83)(H,84,85)(H,86,87)(H,98,99)(H,100,101,102)/t33-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,53-/m0/s1
InChI key:DRTFLFZDIZEZKV-JXKVUTFHSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC2=CC=C(C=C2)OS(=O)(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@H](CC(=O)O)N
Synonyms:
  • Hirudin (55-65) (sulfated)
  • H-Asp-Phe-Glu-Glu-Ile-Pro-Glu-Glu-Tyr(SO3H)-Leu-Gln-OH
Found 3 products.