CymitQuimica logo

CAS 109927-44-8

:

L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-1-methyl-

Description:
L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-1-methyl- is a derivative of the essential amino acid L-Tryptophan, which plays a crucial role in protein synthesis and serves as a precursor for neurotransmitters such as serotonin. This specific compound features a protective group, the 1,1-dimethylethoxycarbonyl, which is often used in organic synthesis to enhance the stability and reactivity of the amino acid during chemical reactions. The presence of the methyl group at the nitrogen atom contributes to its structural uniqueness and may influence its biological activity. This compound is typically characterized by its molecular weight, solubility in organic solvents, and stability under various conditions. It is important in pharmaceutical and biochemical research, particularly in studies related to drug development and metabolic pathways. As with many amino acid derivatives, it may exhibit specific interactions with biological systems, making it a subject of interest in medicinal chemistry and biochemistry.
Formula:C17H22N2O4
InChI:InChI=1S/C17H22N2O4/c1-17(2,3)23-16(22)18-13(15(20)21)9-11-10-19(4)14-8-6-5-7-12(11)14/h5-8,10,13H,9H2,1-4H3,(H,18,22)(H,20,21)/t13-/m0/s1
InChI key:OHPBREBKPBFZCY-ZDUSSCGKSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC1=CN(C2=CC=CC=C21)C)C(=O)O
Found 4 products.