CymitQuimica logo

CAS 1099597-35-9

:

1-Chloro-2,5-difluoro-4-(trifluoromethyl)benzene

Description:
1-Chloro-2,5-difluoro-4-(trifluoromethyl)benzene is an aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features one chlorine atom and three fluorine atoms, which significantly influence its chemical properties. The chlorine atom is located at the first position, while the two fluorine atoms are positioned at the second and fifth positions, and a trifluoromethyl group (-CF3) is attached at the fourth position. This substitution pattern contributes to the compound's high electronegativity and lipophilicity, making it relatively nonpolar. The presence of multiple fluorine atoms enhances its thermal stability and resistance to degradation, which can be advantageous in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique reactivity due to the electron-withdrawing effects of the halogens, potentially influencing its behavior in chemical reactions. Overall, 1-Chloro-2,5-difluoro-4-(trifluoromethyl)benzene is notable for its complex structure and the implications of its halogen substituents on its chemical behavior.
Formula:C7H2ClF5
InChI:InChI=1S/C7H2ClF5/c8-4-2-5(9)3(1-6(4)10)7(11,12)13/h1-2H
InChI key:InChIKey=OSHAWXYKNXIRNX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(F)C=C(Cl)C(F)=C1
Synonyms:
  • Benzene, 1-chloro-2,5-difluoro-4-(trifluoromethyl)-
  • 1-Chloro-2,5-difluoro-4-(trifluoromethyl)benzene
  • 4-Chloro-2,5-difluorobenzotrifluoride
Found 2 products.