CymitQuimica logo

CAS 1099597-86-0

:

2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene

Description:
2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene is a halogenated aromatic compound characterized by the presence of bromine and fluorine substituents on a benzene ring. The molecular structure features a bromine atom at the second position, two fluorine atoms at the first and fifth positions, and a trifluoromethyl group (-CF3) at the third position of the benzene ring. This compound is typically colorless to pale yellow and may exhibit a distinct odor. Its fluorinated groups contribute to its chemical stability and lipophilicity, making it useful in various applications, including pharmaceuticals and agrochemicals. The presence of multiple electronegative halogens can also influence its reactivity, making it a potential candidate for further chemical transformations. Additionally, the compound's physical properties, such as boiling and melting points, are influenced by the steric and electronic effects of the substituents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H2BrF5
InChI:InChI=1S/C7H2BrF5/c8-6-4(7(11,12)13)1-3(9)2-5(6)10/h1-2H
InChI key:InChIKey=IJQIBUQQMOIJPX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C(F)=CC(F)=C1
Synonyms:
  • Benzene, 2-bromo-1,5-difluoro-3-(trifluoromethyl)-
  • 2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene
Found 4 products.