CymitQuimica logo

CAS 1099597-94-0

:

2,5-Dibromo-4-(trifluoromethyl)pyridine

Description:
2,5-Dibromo-4-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with bromine atoms and at the 4 position with a trifluoromethyl group. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties and reactivity. The presence of bromine atoms enhances its electrophilic character, making it useful in various chemical reactions, while the trifluoromethyl group contributes to its lipophilicity and stability. Additionally, the compound may exhibit interesting biological activities, although specific data on its toxicity and environmental impact would require further investigation. As with many halogenated compounds, proper handling and safety precautions are essential due to potential hazards associated with bromine and fluorine. Overall, 2,5-Dibromo-4-(trifluoromethyl)pyridine is a valuable compound in synthetic organic chemistry and material science.
Formula:C6H2Br2F3N
InChI:InChI=1S/C6H2Br2F3N/c7-4-2-12-5(8)1-3(4)6(9,10)11/h1-2H
InChI key:InChIKey=JKLDXTVIVWCPBX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(Br)=CN=C(Br)C1
Synonyms:
  • Pyridine, 2,5-dibromo-4-(trifluoromethyl)-
  • 2,5-Dibromo-4-(trifluoromethyl)pyridine
Found 4 products.