CymitQuimica logo

CAS 1099597-96-2

:

3-Fluoro-5-(trifluoromethyl)pyridine

Description:
3-Fluoro-5-(trifluoromethyl)pyridine is a fluorinated heterocyclic compound characterized by the presence of a pyridine ring substituted with a fluorine atom at the 3-position and a trifluoromethyl group at the 5-position. This compound is part of the pyridine family, which consists of a six-membered aromatic ring containing one nitrogen atom. The introduction of fluorine and trifluoromethyl groups enhances its lipophilicity and can influence its reactivity and biological activity. Typically, such fluorinated compounds exhibit unique properties, including increased stability and altered solubility compared to their non-fluorinated counterparts. They are often utilized in pharmaceuticals, agrochemicals, and materials science due to their ability to modulate electronic properties and improve metabolic stability. The presence of multiple fluorine atoms can also impart distinctive spectroscopic characteristics, making them valuable in analytical chemistry. Overall, 3-Fluoro-5-(trifluoromethyl)pyridine is a compound of interest in various fields, particularly in the development of new chemical entities.
Formula:C6H3F4N
InChI:InChI=1S/C6H3F4N/c7-5-1-4(2-11-3-5)6(8,9)10/h1-3H
InChI key:InChIKey=GWTMPNXPVMDUTM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(F)C=NC1
Synonyms:
  • Pyridine, 3-fluoro-5-(trifluoromethyl)-
  • 3-Fluoro-5-(trifluoromethyl)pyridine
Found 3 products.