CAS 110-16-7: Maleic acid

Description:Maleic acid, with the CAS number 110-16-7, is a colorless, odorless organic compound that belongs to the class of unsaturated dicarboxylic acids. It has the molecular formula C4H4O4 and features two carboxylic acid groups (-COOH) attached to a double-bonded carbon framework. Maleic acid is known for its ability to undergo various chemical reactions, including isomerization to form fumaric acid, which is its geometric isomer. It is soluble in water and polar organic solvents, making it useful in various applications, including as a building block in the synthesis of polymers, resins, and agricultural chemicals. Maleic acid is also utilized in the production of maleic anhydride, which is a key intermediate in the manufacture of several industrial products. Additionally, it exhibits mild acidity and can act as a chelating agent. However, it is important to handle maleic acid with care, as it can be irritating to the skin and eyes.

Formula:C₄H₄O₄

InChI:InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1-

InChI key:InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-N

SMILES:O=C(O)C=CC(=O)O