CymitQuimica logo

CAS 1100212-66-5

:

7-Bromo-5-(trifluoromethyl)-1H-indazole

Description:
7-Bromo-5-(trifluoromethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 7-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The trifluoromethyl group enhances lipophilicity, which can improve the compound's ability to penetrate biological membranes. Additionally, the bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's molecular structure contributes to its stability and solubility characteristics, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-6-2-5(8(10,11)12)1-4-3-13-14-7(4)6/h1-3H,(H,13,14)
InChI key:InChIKey=KRAPGTPHSWVOAC-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(C(F)(F)F)=C1)C=NN2
Synonyms:
  • 7-Bromo-5-(trifluoromethyl)-1H-indazole
  • 1H-Indazole, 7-bromo-5-(trifluoromethyl)-
Found 5 products.