CymitQuimica logo

CAS 1100318-96-4

:

4-iodo-7H-pyrrolo[2,3-d]pyrimidine

Description:
4-Iodo-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of an iodine atom at the 4-position enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound typically exhibits a solid-state at room temperature and may have moderate solubility in polar organic solvents. Its structure allows for various functionalization possibilities, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored for potential therapeutic uses. The presence of the iodine atom can also influence the compound's electronic properties, potentially affecting its interactions with biological targets. Overall, 4-iodo-7H-pyrrolo[2,3-d]pyrimidine is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C6H4IN3
InChI:InChI=1S/C6H4IN3/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H,8,9,10)
InChI key:UEUGYIMGLFJGGX-UHFFFAOYSA-N
SMILES:C1=CNC2=C1C(=NC=N2)I
Found 4 products.