CymitQuimica logo

CAS 1100318-98-6

:

3H-IMidazo[4,5-b]pyridine, 7-iodo-

Description:
3H-Imidazo[4,5-b]pyridine, 7-iodo- is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures. This compound features an iodine atom substituted at the 7-position of the imidazo[4,5-b]pyridine framework, which contributes to its unique chemical properties and potential reactivity. The presence of the iodine atom can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The imidazo[4,5-b]pyridine core is known for its biological activity, often being explored in medicinal chemistry for its potential as a pharmacophore in drug development. This compound may exhibit properties such as fluorescence, making it suitable for applications in imaging or as a probe in biological systems. Additionally, its solubility and stability in different solvents can vary, influencing its application in synthetic and analytical chemistry. Overall, 3H-Imidazo[4,5-b]pyridine, 7-iodo- represents a versatile structure with significant implications in both research and industry.
Formula:C6H4IN3
InChI:InChI=1S/C6H4IN3/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H,(H,8,9,10)
InChI key:LBYJLCPQLCSRHZ-UHFFFAOYSA-N
SMILES:C1=CN=C2C(=C1I)NC=N2
Found 3 products.