CAS 110044-82-1: ALLN
Description:The chemical substance with the name "ALLN" and CAS number 110044-82-1 is known as Aluminum Lithium Nitride. This compound is characterized by its unique combination of aluminum, lithium, and nitrogen, which contributes to its notable properties. It typically exhibits high thermal stability and can withstand elevated temperatures, making it suitable for various high-performance applications. The presence of lithium enhances its electrical conductivity, while aluminum contributes to its structural integrity. Additionally, Aluminum Lithium Nitride is often explored for its potential use in advanced materials, including ceramics and semiconductors, due to its ability to form solid solutions and its favorable mechanical properties. Its synthesis usually involves high-temperature processes, and it may be utilized in applications such as electronic devices, thermal management systems, and as a precursor for other nitride materials. As with many chemical substances, handling precautions should be observed due to potential reactivity and toxicity, emphasizing the importance of safety in laboratory and industrial settings.
Formula:C20H37N3O4
InChI:InChI=1S/C20H37N3O4/c1-7-8-9-16(12-24)22-19(26)18(11-14(4)5)23-20(27)17(10-13(2)3)21-15(6)25/h12-14,16-18H,7-11H2,1-6H3,(H,21,25)(H,22,26)(H,23,27)/t16-,17-,18-/m0/s1
InChI key:InChIKey=FMYKJLXRRQTBOR-BZSNNMDCSA-N
SMILES:O=CC(NC(=O)C(NC(=O)C(NC(=O)C)CC(C)C)CC(C)C)CCCC
- Synonyms:
- <span class="text-smallcaps">L</smallcap>-Leucinamide, N-acetyl-<smallcap>L</span>-leucyl-N-(1-formylpentyl)-, (S)-
- <span class="text-smallcaps">L</smallcap>-Leucinamide, N-acetyl-<smallcap>L</span>-leucyl-N-[(1S)-1-formylpentyl]-
- ALLNal
- ALLnL
- CI-1 (peptide)
- Calp I
- Calpain inhibitor I
- Mg 101
- N-Ac-Leu-Leu-Norleucinal
- N-Acetyl-<span class="text-smallcaps">L</smallcap>-leucinyl-<smallcap>L</smallcap>-leucinyl-<smallcap>L</span>-norleucinal
- See more synonyms
- N-Acetyl-<span class="text-smallcaps">L</smallcap>-leucyl-N-[(1S)-1-formylpentyl]-<smallcap>L</span>-leucinamide
- N-Acetyl-L-Leucyl-L-Leucyl-L-Norleucinal
- N-Acetyl-Leu-Leu-Nle-Cho
- N-Acetyl-Leu-Leu-Norleucinal
- N-acetyl-L-leucyl-N-[(2S)-1-oxohexan-2-yl]-L-leucinamide
- N-acetyl-L-leucyl-N-[(2S)-1-oxohexan-2-yl]leucinamide
- N-acetylleucyl-N-(1-oxohexan-2-yl)leucinamide
- L-Leucinamide, N-acetyl-L-leucyl-N-[(1S)-1-formylpentyl]-
- L-Leucinamide, N-acetyl-L-leucyl-N-(1-formylpentyl)-, (S)-
- N-Acetyl-L-leucyl-N-[(1S)-1-formylpentyl]-L-leucinamide