CymitQuimica logo

CAS 1100748-68-2

:

1-(Phenylmethyl)-1,9-diazaspiro[5.5]undecane

Description:
1-(Phenylmethyl)-1,9-diazaspiro[5.5]undecane, identified by its CAS number 1100748-68-2, is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms integrated into the spiro system. This compound typically exhibits properties associated with both amines and spiro compounds, including potential basicity due to the presence of nitrogen atoms. The phenylmethyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural complexity can lead to diverse reactivity patterns, and it may participate in various chemical reactions typical of amines and spiro compounds. Additionally, the presence of the phenyl group may enhance its ability to interact with biological targets, potentially leading to applications in drug development or as a research tool in studying receptor interactions. Overall, this compound represents a fascinating intersection of organic and medicinal chemistry.
Formula:C16H24N2
InChI:InChI=1S/C16H24N2/c1-2-6-15(7-3-1)14-18-13-5-4-8-16(18)9-11-17-12-10-16/h1-3,6-7,17H,4-5,8-14H2
InChI key:InChIKey=QKKQOABRVDBFKQ-UHFFFAOYSA-N
SMILES:C(N1C2(CCCC1)CCNCC2)C3=CC=CC=C3
Synonyms:
  • 1,9-Diazaspiro[5.5]undecane, 1-(phenylmethyl)-
  • 1-Benzyl-1,9-diazaspiro[5.5]undecane
  • 1-(Phenylmethyl)-1,9-diazaspiro[5.5]undecane
Found 2 products.