CAS 110234-68-9
:4,4,4-Trifluoro-3-oxobutanenitrile
Description:
4,4,4-Trifluoro-3-oxobutanenitrile, with the CAS number 110234-68-9, is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a trifluoromethyl group, which significantly influences its reactivity and physical properties, making it a valuable intermediate in organic synthesis. The presence of the nitrile group contributes to its polarity and potential for hydrogen bonding, while the ketone functionality enhances its reactivity in various chemical reactions, such as nucleophilic additions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its fluorinated nature often imparts increased stability and resistance to degradation, making it useful in pharmaceuticals and agrochemicals. Additionally, the compound's properties may include a relatively high boiling point and low volatility, which are common in fluorinated compounds. Safety considerations are essential when handling this substance, as it may pose health risks, including toxicity and environmental concerns. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C4H2F3NO
InChI:InChI=1/C4H2F3NO/c5-4(6,7)3(9)1-2-8/h1H2
SMILES:C(C#N)C(=O)C(F)(F)F
Synonyms:- 4,4,4-Trifluoro-3-oxobutyronitrile
- Butanenitrile, 4,4,4-Trifluoro-3-Oxo-
- Nc1Vxfff
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,4,4-Trifluoro-3-oxobutanenitrile
CAS:Formula:C4H2F3NOPurity:95%Color and Shape:LiquidMolecular weight:137.06004,4,4-Trifluoro-3-oxobutanenitrile
CAS:4,4,4-Trifluoro-3-oxobutanenitrilePurity:≥95%Color and Shape:LiquidMolecular weight:137.06g/mol4,4,4-TRIFLUORO-3-OXOBUTANENITRILE
CAS:Formula:C4H2F3NOPurity:95.0%Color and Shape:LiquidMolecular weight:137.0614,4,4-Trifluoro-3-oxobutanenitrile
CAS:Controlled ProductFormula:C4H2F3NOColor and Shape:NeatMolecular weight:137.064,4,4-Trifluoro-3-oxobutanenitrile
CAS:<p>4,4,4-Trifluoro-3-oxobutanenitrile is a synthetic chemical that is used in medicine as an anti-cancer agent. It inhibits the growth of cells by binding to their DNA and preventing the production of proteins needed for cellular division. This drug also has an inhibitory effect on fungal growth, inhibiting the synthesis of ergosterol in fungi by binding to it and blocking its conversion to lanosterol. 4,4,4-Trifluoro-3-oxobutanenitrile is a nitro compound that reacts with hydroxyl groups in alkynes to form reactive intermediates which react with alkylamines to produce N2O2 or directly react with DNA. The aromatic hydrocarbon group prevents these reactive intermediates from reacting with organic molecules.</p>Formula:C4H2F3NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:137.06 g/mol




