CymitQuimica logo

CAS 110234-68-9

:

4,4,4-Trifluoro-3-oxobutanenitrile

Description:
4,4,4-Trifluoro-3-oxobutanenitrile, with the CAS number 110234-68-9, is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a trifluoromethyl group, which significantly influences its reactivity and physical properties, making it a valuable intermediate in organic synthesis. The presence of the nitrile group contributes to its polarity and potential for hydrogen bonding, while the ketone functionality enhances its reactivity in various chemical reactions, such as nucleophilic additions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its fluorinated nature often imparts increased stability and resistance to degradation, making it useful in pharmaceuticals and agrochemicals. Additionally, the compound's properties may include a relatively high boiling point and low volatility, which are common in fluorinated compounds. Safety considerations are essential when handling this substance, as it may pose health risks, including toxicity and environmental concerns. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C4H2F3NO
InChI:InChI=1/C4H2F3NO/c5-4(6,7)3(9)1-2-8/h1H2
InChI key:RDNQEPVYJCVARF-UHFFFAOYSA-N
SMILES:C(C#N)C(=O)C(F)(F)F
Synonyms:
  • 4,4,4-Trifluoro-3-oxobutyronitrile
  • Butanenitrile, 4,4,4-Trifluoro-3-Oxo-
  • Nc1Vxfff
Found 5 products.