
CAS 11024-56-9
:(2S,4aS,4bR,6aS,12bS,12cS,14aS)-3,4,4a,4b,5,6,6a,7,12,12b,12c,13,14,14a-Tetradecahydro-α,α,4a,12b,12c-pentamethyl-2H-1-benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-2-methanol
Description:
The chemical substance with the name "(2S,4aS,4bR,6aS,12bS,12cS,14aS)-3,4,4a,4b,5,6,6a,7,12,12b,12c,13,14,14a-Tetradecahydro-α,α,4a,12b,12c-pentamethyl-2H-1-benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-2-methanol" and CAS number 11024-56-9 is a complex organic compound characterized by its intricate polycyclic structure and multiple stereocenters. This compound features a fused ring system that includes both benzopyrano and indole moieties, contributing to its unique chemical properties. The presence of multiple methyl groups enhances its hydrophobic character, while the hydroxymethyl group suggests potential for hydrogen bonding and solubility in polar solvents. Its stereochemistry indicates specific spatial arrangements that can influence its biological activity and reactivity. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential pharmacological properties. Overall, this substance exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of polycyclic compounds.
Formula:C28H39NO2
InChI:InChI=1S/C28H39NO2/c1-25(2,30)22-12-14-26(3)21-11-10-17-16-19-18-8-6-7-9-20(18)29-24(19)28(17,5)27(21,4)15-13-23(26)31-22/h6-9,17,21-23,29-30H,10-16H2,1-5H3/t17-,21-,22-,23-,26-,27-,28+/m0/s1
InChI key:InChIKey=WLAIEIMDXUAGPY-HSECPPETSA-N
SMILES:C[C@]12C3=C(C[C@@]1(CC[C@@]4([C@]2(C)CC[C@]5([C@@]4(C)CC[C@@H](C(C)(C)O)O5)[H])[H])[H])C=6C(N3)=CC=CC6
Synonyms:- Paspalin
- 2H-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-2-methanol, 3,4,4a,4b,5,6,6a,7,12,12b,12c,13,14,14a-tetradecahydro-α,α,4a,12b,12c-pentamethyl-, (2S,4aS,4bR,6aS,12bS,12cS,14aS)-
- 2H-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-2-methanol, 3,4,4a,4b,5,6,6a,7,12,12b,12c,13,14,14a-tetradecahydro-α,α,4a,12b,12c-pentamethyl-, [2S-(2α,4aα,4bβ,6aα,12bβ,12cα,14aβ)]-
- (2S,4aS,4bR,6aS,12bS,12cS,14aS)-3,4,4a,4b,5,6,6a,7,12,12b,12c,13,14,14a-Tetradecahydro-α,α,4a,12b,12c-pentamethyl-2H-1-benzopyrano[5′,6′:6,7]indeno[1,2-b]indole-2-methanol
- Paspaline
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Paspaline
CAS:Paspaline is an indole-diterpene.Formula:C28H39NO2Color and Shape:SolidMolecular weight:421.61
