CymitQuimica logo

CAS 11029-61-1

:

Gramicidin A

Description:
Gramicidin A is a linear peptide antibiotic that is primarily derived from the bacterium Bacillus brevis. It is composed of a sequence of amino acids and is known for its ability to disrupt bacterial cell membranes, leading to cell lysis. Gramicidin A exhibits a unique structure characterized by a cyclic arrangement of its amino acids, which contributes to its amphipathic nature, allowing it to interact with lipid bilayers effectively. This antibiotic is particularly effective against Gram-positive bacteria and is often used in topical formulations for its antibacterial properties. In addition to its antimicrobial activity, Gramicidin A has been studied for its ionophoric properties, facilitating the transport of ions across membranes. It is important to note that while Gramicidin A is effective against certain pathogens, its use is limited due to potential toxicity and the development of resistance. As a result, it is primarily utilized in specific clinical applications, particularly in ophthalmic and otic preparations.
Formula:Unspecified
InChI:InChI=1/C99H140N20O17/c1-51(2)37-73(109-86(123)59(17)107-81(122)49-105-96(133)82(55(9)10)106-50-121)89(126)108-60(18)87(124)117-84(57(13)14)98(135)119-85(58(15)16)99(136)118-83(56(11)12)97(134)116-80(44-64-48-104-72-34-26-22-30-68(64)72)95(132)112-76(40-54(7)8)92(129)115-79(43-63-47-103-71-33-25-21-29-67(63)71)94(131)111-75(39-53(5)6)91(128)114-78(42-62-46-102-70-32-24-20-28-66(62)70)93(130)110-74(38-52(3)4)90(127)113-77(88(125)100-35-36-120)41-61-45-101-69-31-23-19-27-65(61)69/h19-34,45-48,50-60,73-80,82-85,101-104,120H,35-44,49H2,1-18H3,(H,100,125)(H,105,133)(H,106,121)(H,107,122)(H,108,126)(H,109,123)(H,110,130)(H,111,131)(H,112,132)(H,113,127)(H,114,128)(H,115,129)(H,116,134)(H,117,124)(H,118,136)(H,119,135)/t59-,60-,73+,74+,75+,76+,77-,78-,79-,80-,82-,83+,84+,85-/m0/s1
InChI key:ZWCXYZRRTRDGQE-LUPIJMBPSA-N
SMILES:C[C@@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC3=CNC4=CC=CC=C43)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC5=CNC6=CC=CC=C65)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC7=CNC8=CC=CC=C87)C(=O)NCCO)NC(=O)CNC(=O)[C@H](C(C)C)NC=O
Synonyms:
  • Gramicidin A
Found 4 products.