CymitQuimica logo

CAS 110311-45-0

:

(S)-2-(4-fluorophenyl)-3-methylbutyric acid

Description:
(S)-2-(4-fluorophenyl)-3-methylbutyric acid, with the CAS number 110311-45-0, is a chiral compound that belongs to the class of carboxylic acids. It features a branched aliphatic chain with a fluorinated aromatic substituent, which contributes to its unique properties. The presence of the 4-fluorophenyl group enhances its lipophilicity and may influence its biological activity. This compound is characterized by its ability to form hydrogen bonds due to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Its chirality indicates that it exists in two enantiomeric forms, with the (S)-configuration being of particular interest in pharmaceutical applications, as stereochemistry can significantly affect the efficacy and safety of drug candidates. Additionally, the compound's solubility, melting point, and reactivity can vary based on the specific conditions and solvents used. Overall, (S)-2-(4-fluorophenyl)-3-methylbutyric acid is a compound of interest in medicinal chemistry and material science.
Formula:C11H13FO2
InChI:InChI=1S/C11H13FO2/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10H,1-2H3,(H,13,14)/t10-/m1/s1
InChI key:YBQLHBYGMUXCEW-SNVBAGLBSA-N
SMILES:CC(C)[C@H](C1=CC=C(C=C1)F)C(=O)O
Found 4 products.