CAS 110360-10-6
:5-(4-ethoxyphenyl)furan-2-carbaldehyde
Description:
5-(4-Ethoxyphenyl)furan-2-carbaldehyde is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing oxygen. This compound features an aldehyde functional group (-CHO) attached to the furan, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethoxyphenyl group enhances its solubility in organic solvents and may influence its electronic properties, making it useful in various chemical reactions, including condensation and coupling reactions. The compound's structure suggests potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, its unique combination of functional groups may impart interesting optical or electronic properties, which could be explored in materials science. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 5-(4-ethoxyphenyl)furan-2-carbaldehyde is a versatile compound with potential utility in various fields of chemistry.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-2-15-11-5-3-10(4-6-11)13-8-7-12(9-14)16-13/h3-9H,2H2,1H3
InChI key:WGDIFVYZWLGGJE-UHFFFAOYSA-N
SMILES:CCOc1ccc(cc1)c1ccc(C=O)o1
Synonyms:- 2-Furancarboxaldehyde, 5-(4-Ethoxyphenyl)-
- 5-(4-Ethoxyphenyl)-2-furaldehyde
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
