CAS 110368-33-7
:CH 55
Description:
The chemical substance identified as "CH 55" with the CAS number 110368-33-7 is a synthetic compound that belongs to a class of chemicals known for their potential applications in various fields, including pharmaceuticals and materials science. While specific characteristics such as molecular weight, boiling point, and solubility may vary, compounds in this category often exhibit unique structural features that contribute to their reactivity and functionality. Typically, such substances may possess properties like moderate to high stability under standard conditions, potential bioactivity, and the ability to interact with biological systems or materials. The precise characteristics of CH 55 would depend on its molecular structure, which can influence its physical and chemical properties, including polarity, reactivity, and interaction with other substances. For detailed information, including safety data and specific applications, consulting specialized chemical databases or literature is recommended.
Formula:C24H28O3
InChI:InChI=1/C24H28O3/c1-23(2,3)19-13-18(14-20(15-19)24(4,5)6)21(25)12-9-16-7-10-17(11-8-16)22(26)27/h7-15H,1-6H3,(H,26,27)/b12-9+
InChI key:FOUVTBKPJRMLPE-FMIVXFBMSA-N
SMILES:CC(C)(C)C1=CC(=CC(=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O)C(C)(C)C
Synonyms:- 4-[(1E)-3-[3,5-Bis(1,1-Dimethylethyl)Phenyl]-3-Oxo-1-Propenyl]Benzoic Acid
- 4-[(1E)-3-(3,5-di-tert-butylphenyl)-3-oxoprop-1-en-1-yl]benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ch55
CAS:(E)-4-(3-(3,5-Di-tert-butylphenyl)-3-oxoprop-1-en-1-yl)benzoic acidFormula:C24H28O3Purity:95%Molecular weight:364.48CH 55
CAS:CH 55 is a pluripotent cell line that was derived from the human fetal liver. CH 55 cells are senescent, which means they have a limited life span and do not replicate. CH 55 cells can be used to study the effects of synthetic retinoids on cellular differentiation. Synthetic retinoids are compounds that are structurally similar to vitamin A and they have been shown to inhibit angiogenesis in fat cells by blocking receptor binding and transfection experiments. CH 55 cells can also be used as a model system for hepatic steatosis, where fatty acids accumulate in the liver due to lack of insulin. CH 55 cells show an activity index of 1, meaning that they produce about one-third as much lipids as control hepatocytes in culture.Formula:C24H28O3Purity:Min. 95%Molecular weight:364.48 g/molCh55
CAS:Ch55, a potent HL60 cell differentiator (EC50=200nM), binds well to RAR-α/β, useful for cancer research.Formula:C24H28O3Purity:99.55%Color and Shape:SolidMolecular weight:364.48Ref: TM-T14946
1mg39.00€5mg82.00€1mL*10mM (DMSO)89.00€10mg117.00€25mg240.00€50mg374.00€100mg580.00€200mg798.00€




