CAS 110407-59-5
:1-Bromo-2-chloro-4-fluorobenzene
Description:
1-Bromo-2-chloro-4-fluorobenzene is an aromatic halogenated compound characterized by the presence of three halogen substituents on a benzene ring. Specifically, it features a bromine atom, a chlorine atom, and a fluorine atom attached to the benzene at the 1, 2, and 4 positions, respectively. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its moderate volatility and relatively low solubility in water, making it more soluble in organic solvents. The presence of multiple halogens contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, 1-bromo-2-chloro-4-fluorobenzene can serve as an important intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its physical and chemical properties, such as boiling point and density, are influenced by the electronegativity and size of the halogen substituents, which also affect its overall stability and reactivity in various chemical environments.
Formula:C6H3BrClF
InChI:InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H
SMILES:c1cc(c(cc1F)Cl)Br
Synonyms:- 4-Bromo-3-chlorofluorobenzene
- 2-Chloro-4-Fluorobromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Bromo-2-chloro-4-fluorobenzene
CAS:Formula:C6H3BrClFPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:209.441-Bromo-2-chloro-4-fluorobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrClFPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:209.442-Chloro-4-fluorobromobenzene
CAS:2-Chloro-4-fluorobromobenzeneFormula:C6H3BrClFPurity:98%Color and Shape:Colourless LiquidMolecular weight:209.443421-Bromo-2-chloro-4-fluorobenzene
CAS:Formula:C6H3BrClFPurity:98%Color and Shape:LiquidMolecular weight:209.44344-Bromo-3-chloro-1-fluorobenzene
CAS:Formula:C6H3BrClFPurity:98%Color and Shape:LiquidMolecular weight:209.441-Bromo-2-chloro-4-fluorobenzene
CAS:1-Bromo-2-chloro-4-fluorobenzene is a chemical compound with the molecular formula C6H5BrClF. The 1-bromo-2-chloro-4-fluorobenzene is a monomer that reacts with sulfuric acid to form 1,2,3,4,5,6,7,8-octahydrobenzo[a]pyrene. This compound has been shown to be an effective herbicide when applied to plants in the presence of nitrite and hydrobromic acid. It has also been used as a precursor for other brominated compounds such as 1,2,3,4,5,6,7,8,-octahydrobenzo[a]pyrene diazotized with sodium nitrite.Formula:C6H3BrClFPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:209.44 g/mol





