CymitQuimica logo

CAS 1104276-29-0

:

4-Methyl-2-(2-pyrimidinyl)-5-thiazolecarboxylic acid

Description:
4-Methyl-2-(2-pyrimidinyl)-5-thiazolecarboxylic acid is a heterocyclic compound characterized by the presence of both thiazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, making it acidic in nature. The thiazole ring, containing sulfur and nitrogen, imparts distinct reactivity and potential biological activity, while the pyrimidine moiety adds to its aromatic character and may influence its interactions in biological systems. The methyl group at the 4-position of the thiazole enhances its lipophilicity, potentially affecting its solubility and permeability. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural complexity allows for diverse applications, particularly in drug development and synthesis. As with many heterocycles, the specific interactions and reactivity can be influenced by substituents and the overall molecular conformation, which are critical for understanding its behavior in chemical reactions and biological systems.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c1-5-6(9(13)14)15-8(12-5)7-10-3-2-4-11-7/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=LSOLFLCPKUKMAX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(=NC1C)C=2N=CC=CN2
Synonyms:
  • 4-Methyl-2-(2-pyrimidinyl)-5-thiazolecarboxylic acid
  • 5-Thiazolecarboxylic acid, 4-methyl-2-(2-pyrimidinyl)-
  • 4-Methyl-2-(pyrimidin-2-yl)thiazole-5-carboxylic acid
  • 4-Methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid
  • 4-Methyl-2-(2-pyrimidinyl)thiazole-5-carboxylic acid, 97%
Found 4 products.