CAS 110457-87-9

Formula: C10H13N5O4

InChI: InChI=1S/C10H13N5O4/c11-8-12-9-14(1-2-15(9)10(18)13-8)7-3-5(17)6(4-16)19-7/h1-2,5-7,16-17H,3-4H2,(H2,11,13,18)/t5-,6+,7+/m0/s1

InChI key: SBQDZMTWLNGLQA-RRKCRQDMSA-N

SMILES: C1[C@@H]([C@H](O[C@H]1N2C=CN3C2=NC(=NC3=O)N)CO)O

2-Amino-8-(2-deoxy-β-D-ribofuranosyl)-imidazo[1,2-α]-1,3,5-triazin-4(8H)-one

CAS: 110457-87-9

2-Amino-8-(2-deoxy-β-D-ribofuranosyl)-imidazo[1,2-α]-1,3,5-triazin-4(8H)-one is a modified nucleoside analog with the following structure: the core heterocyclic structure is a fused imidazole-triazine ring, there is a 2-amino group at position 2 of the imidazole ring and it has a 2-deoxy-β-D-ribofuranose sugar attached at the 8-position of the heterocyclic ring, making it structurally related to DNA nucleosides.

Formula: C₁₀H₁₃N₅O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 267.24 g/mol

Ref: 3D-NA145593