CymitQuimica logo

CAS 110477-51-5

:

Silane, trimethyl-, homopolymer

Description:
Trimethylsilane homopolymer, identified by CAS number 110477-51-5, is a silicone-based polymer characterized by its unique structure derived from trimethylsilane monomers. This polymer exhibits excellent thermal stability and resistance to moisture, making it suitable for various applications in coatings, adhesives, and sealants. Its chemical structure imparts flexibility and durability, contributing to its performance in harsh environments. Additionally, trimethylsilane homopolymer is known for its low surface energy, which enhances its hydrophobic properties, making it effective in repelling water and other liquids. The polymer's compatibility with other materials allows for versatile formulations in industrial applications. Furthermore, it is generally non-toxic and environmentally friendly, aligning with increasing demands for sustainable materials. Overall, trimethylsilane homopolymer is valued for its combination of mechanical strength, chemical resistance, and adaptability in diverse applications across multiple industries.
Formula:(C3H10Si)x
InChI:InChI=1S/C3H10Si/c1-4(2)3/h4H,1-3H3
InChI key:InChIKey=PQDJYEQOELDLCP-UHFFFAOYSA-N
SMILES:[SiH](C)(C)C
Synonyms:
  • Poly(trimethylsilane)
  • Silane, trimethyl-, homopolymer
  • Trimethylsilane homopolymer
Found 1 products.