CymitQuimica logo

CAS 110482-96-7

:

ethyl 2,2-difluoropent-4-enoate

Description:
Ethyl 2,2-difluoropent-4-enoate is an organic compound characterized by its structure, which includes a pentene backbone with a double bond and two fluorine atoms attached to the second carbon. This compound belongs to the class of esters, specifically an ethyl ester, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. The presence of fluorine atoms imparts unique properties, such as increased lipophilicity and potential reactivity in various chemical reactions. Ethyl 2,2-difluoropent-4-enoate is typically a colorless liquid at room temperature and may have a distinctive odor. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, owing to the reactivity of the double bond and the influence of the fluorine substituents. Safety data sheets would indicate handling precautions due to its chemical nature, and it is essential to consider its environmental impact and regulatory status in various jurisdictions.
Formula:C7H10F2O2
InChI:InChI=1/C7H10F2O2/c1-3-5-7(8,9)6(10)11-4-2/h3H,1,4-5H2,2H3
InChI key:YWORETBGSIWDRB-UHFFFAOYSA-N
SMILES:C=CCC(C(=O)OCC)(F)F
Synonyms:
  • 4-Pentenoic Acid, 2,2-Difluoro-, Ethyl Ester
Found 4 products.