CymitQuimica logo

CAS 110514-23-3

:

3-(3,5-dimethylpiperidin-1-yl)propan-1-ol

Description:
3-(3,5-Dimethylpiperidin-1-yl)propan-1-ol, with the CAS number 110514-23-3, is an organic compound characterized by its piperidine ring structure and a propanol side chain. This substance features a piperidine moiety that is substituted with two methyl groups at the 3 and 5 positions, contributing to its steric and electronic properties. The presence of the hydroxyl (-OH) group in the propanol chain enhances its solubility in polar solvents and may influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and alcohol-based transformations. The compound's structure suggests it may exhibit basic properties due to the nitrogen atom in the piperidine ring, which can participate in hydrogen bonding. Additionally, the steric hindrance introduced by the dimethyl substitutions may affect its biological activity and interaction with other molecules. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.
Formula:C10H21NO
InChI:InChI=1/C10H21NO/c1-9-6-10(2)8-11(7-9)4-3-5-12/h9-10,12H,3-8H2,1-2H3
SMILES:CC1CC(C)CN(CCCO)C1
Found 1 products.