CymitQuimica logo

CAS 1105194-36-2

:

Ethyl 2-amino-3-(2-benzothiazolyl)-4,7-dihydrothieno[2,3-c]pyridine-6(5H)-carboxylate

Description:
Ethyl 2-amino-3-(2-benzothiazolyl)-4,7-dihydrothieno[2,3-c]pyridine-6(5H)-carboxylate is a complex organic compound characterized by its unique structural features, which include a thieno[2,3-c]pyridine core fused with a benzothiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of an ethyl ester group suggests it may participate in esterification reactions, while the amino group can engage in hydrogen bonding and nucleophilic reactions. Its molecular structure indicates potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound may exhibit fluorescence properties due to the presence of aromatic systems, which can be advantageous in various analytical applications. Overall, the characteristics of this compound highlight its potential utility in research and development within the fields of organic chemistry and drug discovery.
Formula:C17H17N3O2S2
InChI:InChI=1S/C17H17N3O2S2/c1-2-22-17(21)20-8-7-10-13(9-20)23-15(18)14(10)16-19-11-5-3-4-6-12(11)24-16/h3-6H,2,7-9,18H2,1H3
InChI key:InChIKey=FFXAIVQIXUTSDE-UHFFFAOYSA-N
SMILES:NC1=C(C2=C(CN(C(OCC)=O)CC2)S1)C3=NC=4C(S3)=CC=CC4
Synonyms:
  • Ethyl 2-amino-3-(2-benzothiazolyl)-4,7-dihydrothieno[2,3-c]pyridine-6(5H)-carboxylate
  • Thieno[2,3-c]pyridine-6(5H)-carboxylic acid, 2-amino-3-(2-benzothiazolyl)-4,7-dihydro-, ethyl ester
Found 1 products.