CymitQuimica logo

CAS 110522-84-4

:

Dmt-Dcytidine (N6-Benzoyl) Cyanoethyl Phosphoramidite

Description:
Dmt-Dcytidine (N6-Benzoyl) Cyanoethyl Phosphoramidite, with the CAS number 110522-84-4, is a chemical compound commonly used in the field of nucleic acid chemistry, particularly in the synthesis of oligonucleotides. This compound features a DMT (dimethoxytrityl) protecting group, which is crucial for the selective protection of the 5' hydroxyl group during synthesis. The N6-benzoyl modification enhances the stability and solubility of the nucleoside, while the cyanoethyl phosphoramidite moiety facilitates the formation of phosphodiester bonds during the oligonucleotide assembly process. The presence of the phosphoramidite group allows for efficient coupling reactions, making it a valuable reagent in automated DNA synthesis. Additionally, the compound's structural characteristics contribute to its reactivity and compatibility with various coupling conditions, which are essential for achieving high yields and purity in oligonucleotide production. Overall, Dmt-Dcytidine (N6-Benzoyl) Cyanoethyl Phosphoramidite is an important tool in molecular biology and genetic research.
Formula:C43H54N5O8P
InChI:InChI=1S/C43H54N5O8P/c1-29(2)41(49)45-39-23-25-47(42(50)46-39)40-27-37(56-57(54-26-12-24-44)48(30(3)4)31(5)6)38(55-40)28-53-43(32-13-10-9-11-14-32,33-15-19-35(51-7)20-16-33)34-17-21-36(52-8)22-18-34/h9-11,13-23,25,29-31,37-38,40H,12,26-28H2,1-8H3,(H,45,46,49,50)/t37-,38+,40+,57?/m0/s1
InChI key:TXZRTLKYXTXDQF-PBRWWWDFSA-N
SMILES:CC(C)C(=O)NC1=NC(=O)N(C=C1)[C@H]2C[C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N
Synonyms:
  • IBU-4,4'-DMT-deoxycytidine cyanoethyl DIIP phosphoramidite
  • ibu-dC Phosphoramidite
  • Dmt-Dcytidine (N6-Benzoyl) Cyanoethyl Phosphoramidite)
Found 3 products.