CymitQuimica logo

CAS 110525-54-7

:

4-(2-METHYL-IMIDAZOL-1-YL)-BUTYRIC ACID

Description:
4-(2-Methyl-imidazol-1-yl)-butyric acid, with the CAS number 110525-54-7, is an organic compound characterized by its imidazole and carboxylic acid functional groups. This substance features a butyric acid backbone, which contributes to its potential as a bioactive molecule. The presence of the 2-methyl-imidazole moiety suggests that it may exhibit unique chemical reactivity and biological activity, possibly influencing its solubility and interaction with biological targets. Typically, compounds of this nature may be investigated for their pharmacological properties, including anti-inflammatory or neuroprotective effects. The molecular structure allows for various forms of intermolecular interactions, such as hydrogen bonding, which can affect its stability and reactivity. Additionally, the compound's characteristics, such as melting point, solubility, and spectral properties, would be essential for understanding its behavior in different environments. Overall, 4-(2-Methyl-imidazol-1-yl)-butyric acid represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C8H12N2O2
InChI:InChI=1/C8H12N2O2/c1-7-9-4-6-10(7)5-2-3-8(11)12/h4,6H,2-3,5H2,1H3,(H,11,12)
SMILES:Cc1nccn1CCCC(=O)O
Synonyms:
  • Timtec-Bb Sbb010495
  • Akos Bc-1205
  • 4-(2-Methyl-1H-Imidazol-1-Yl)Butanoic Acid
  • 2-Methyl-1H-Imidazole-1-Butanoic Acid
Found 1 products.