CymitQuimica logo

CAS 110525-56-9

:

1H-Pyrazole-1-butanoic acid

Description:
1H-Pyrazole-1-butanoic acid, with the CAS number 110525-56-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a butanoic acid side chain, contributing to its carboxylic acid functional group, which is known for its acidic properties. The presence of the pyrazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. Typically, 1H-Pyrazole derivatives exhibit a range of pharmacological effects, including anti-inflammatory and analgesic properties. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the pyrazole ring may influence its lipophilicity. Additionally, the structural configuration can lead to specific stereochemical properties, affecting its reactivity and interaction with biological targets. Overall, 1H-Pyrazole-1-butanoic acid represents a versatile scaffold in organic synthesis and pharmaceutical applications.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c10-7(11)3-1-5-9-6-2-4-8-9/h2,4,6H,1,3,5H2,(H,10,11)
InChI key:InChIKey=PQTCGHYOOHMITR-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1C=CC=N1
Synonyms:
  • 1H-Pyrazole-1-butanoic acid
Found 2 products.