CymitQuimica logo

CAS 110546-20-8

:

1,4-Bis(2-hydroxy-3,5-di-tert-butylbenzyl)piperazine

Description:
1,4-Bis(2-hydroxy-3,5-di-tert-butylbenzyl)piperazine, with CAS number 110546-20-8, is a chemical compound characterized by its piperazine core, which is substituted at the 1 and 4 positions with bulky, hydrophobic groups. The presence of two 2-hydroxy-3,5-di-tert-butylbenzyl moieties contributes to its significant steric hindrance and lipophilicity. This compound is known for its antioxidant properties, making it useful in various applications, including as a stabilizer in polymers and other materials susceptible to oxidative degradation. Its hydroxyl groups enhance its solubility in polar solvents, while the tert-butyl groups provide thermal stability and resistance to oxidation. Additionally, the compound's structure suggests potential interactions with biological systems, although specific biological activity would depend on further studies. Overall, 1,4-Bis(2-hydroxy-3,5-di-tert-butylbenzyl)piperazine is notable for its unique structural features and functional properties, which make it valuable in both industrial and research contexts.
Formula:C34H54N2O2
InChI:InChI=1S/C34H54N2O2/c1-31(2,3)25-17-23(29(37)27(19-25)33(7,8)9)21-35-13-15-36(16-14-35)22-24-18-26(32(4,5)6)20-28(30(24)38)34(10,11)12/h17-20,37-38H,13-16,21-22H2,1-12H3
InChI key:LAVRPTJDIGXPLJ-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)CN2CCN(CC2)CC3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)O
Found 1 products.