CymitQuimica logo

CAS 1105663-96-4

:

1-tert-butyl 3-ethyl 3-cyanoazetidine-1,3-dicarboxylate

Description:
1-tert-butyl 3-ethyl 3-cyanoazetidine-1,3-dicarboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a tert-butyl group and an ethyl group, contributing to its hydrophobic characteristics, while the cyano and dicarboxylate functionalities introduce polar characteristics, enhancing its reactivity and potential for hydrogen bonding. The presence of the cyano group suggests potential applications in organic synthesis and as a building block for more complex molecules. The dicarboxylate moiety indicates that it can participate in various chemical reactions, such as esterification and amidation. This compound may exhibit interesting biological activities due to its unique structure, making it a candidate for further research in medicinal chemistry. Additionally, its stability and solubility in organic solvents can facilitate its use in various chemical processes. As with any chemical substance, safety data and handling precautions should be observed, particularly due to the presence of reactive functional groups.
Formula:C12H18N2O4
InChI:InChI=1S/C12H18N2O4/c1-5-17-9(15)12(6-13)7-14(8-12)10(16)18-11(2,3)4/h5,7-8H2,1-4H3
InChI key:InChIKey=OZRWQLNFGSPWGB-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(C#N)CN(C(OC(C)(C)C)=O)C1
Synonyms:
  • 1-tert-Butyl 3-ethyl 3-cyanoazetidine-1,3-dicarboxylate
  • 3-Cyano-azetidine-1,3-dicarboxylic acid 1-tert-butyl ester 3-ethyl ester
  • 1,3-Azetidinedicarboxylic acid, 3-cyano-, 1-(1,1-dimethylethyl) 3-ethyl ester
  • 1-(1,1-Dimethylethyl) 3-ethyl 3-cyano-1,3-azetidinedicarboxylate
  • Ethyl 1-Boc-3-cyanoazetid...
  • Ethyl 1-Boc-3-cyanoazetidine-3-carboxylate
Found 3 products.