CAS 110578-73-9
:1,2,4-Oxadiazole-3-carboxamide, N-(2-hydroxyethyl)-5-methyl-
Description:
1,2,4-Oxadiazole-3-carboxamide, N-(2-hydroxyethyl)-5-methyl- is a chemical compound characterized by its oxadiazole ring, which contributes to its heterocyclic structure. This compound features a carboxamide functional group, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of a hydroxyethyl group introduces additional hydrophilicity, while the methyl group at the 5-position of the oxadiazole ring can influence its lipophilicity and biological activity. The molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the oxadiazole moiety's known bioactivity. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require empirical investigation. Its stability and reactivity can be influenced by the substituents on the oxadiazole ring, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to heterocyclic frameworks.
Formula:C6H9N3O3
InChI:InChI=1S/C6H9N3O3/c1-4-8-5(9-12-4)6(11)7-2-3-10/h10H,2-3H2,1H3,(H,7,11)
InChI key:IWNBPGSCYNJNMQ-UHFFFAOYSA-N
SMILES:CC1=NC(=NO1)C(=O)NCCO
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N-(2-Hydroxyethyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide
CAS:Applications N-(2-Hydroxyethyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide is a photolysis product of Metronidazole (M338880), an antibiotic.
References Moore, Douglas E., et al.: Radiation Phy. and Chem., 36(4), 547-50 (1990)Formula:C6H9N3O3Color and Shape:NeatMolecular weight:171.154


