CymitQuimica logo

CAS 1106871-37-7

:

1,4-Dioxaspiro[4.5]decane,8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
1,4-Dioxaspiro[4.5]decane,8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both dioxane and dioxaborolane functionalities. The presence of the dioxaspiro framework contributes to its potential applications in organic synthesis and materials science, particularly in the development of novel polymers or as intermediates in chemical reactions. The tetramethyl-1,3,2-dioxaborolane moiety enhances its reactivity, making it a valuable building block in boron chemistry, which is significant for various applications, including drug discovery and catalysis. This compound may exhibit interesting physical properties such as solubility in organic solvents and specific melting or boiling points, influenced by its molecular structure. Additionally, its stability and reactivity can be affected by environmental factors such as temperature and pH. Overall, the unique structural features of this compound suggest potential utility in various chemical applications, although specific experimental data would be necessary to fully characterize its properties and behavior.
Formula:C14H25BO4
InChI:InChI=1S/C14H25BO4/c1-12(2)13(3,4)19-15(18-12)11-5-7-14(8-6-11)16-9-10-17-14/h11H,5-10H2,1-4H3
InChI key:JAEUAPKITKWJML-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2CCC3(CC2)OCCO3
Found 4 products.