CymitQuimica logo

CAS 110690-36-3

:

1-HEXANOL, 2,6-DIAMINO-, (2S)-

Description:
1-Hexanol, 2,6-diamino-, (2S)-, with the CAS number 110690-36-3, is an organic compound characterized by its long carbon chain and the presence of amino groups. This substance features a hexanol backbone, which consists of six carbon atoms, and two amino groups located at the 2 and 6 positions of the carbon chain. The (2S) designation indicates the specific stereochemistry of the molecule, highlighting its chiral nature. Typically, compounds like this exhibit properties such as moderate solubility in water due to the presence of the hydroxyl group, while the amino groups can participate in hydrogen bonding, influencing their reactivity and interaction with other molecules. The presence of both hydroxyl and amino functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Overall, its unique structure and functional groups contribute to its diverse potential applications in various fields of chemistry and biochemistry.
Formula:C6H16N2O
InChI:InChI=1S/C6H16N2O/c7-4-2-1-3-6(8)5-9/h6,9H,1-5,7-8H2/t6-/m0/s1
InChI key:LTGPFZWZZNUIIK-LURJTMIESA-N
SMILES:C(CCN)C[C@@H](CO)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.